C19H28FN5O4S2 — CID 22141110
N-[[3-[3-fluoro-4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide (PubChem CID 22141110) has the molecular formula C19H28FN5O4S2 and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 22141110 |
| Molecular Formula | C19H28FN5O4S2 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
| SMILES | CNS(=O)(=O)N1CCN(c2ccc(N3CC(CNC(=S)C(C)C)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H28FN5O4S2/c1-13(2)18(30)22-11-15-12-25(19(26)29-15)14-4-5-17(16(20)10-14)23-6-8-24(9-7-23)31(27,28)21-3/h4-5,10,13,15,21H,6-9,11-12H2,1-3H3,(H,22,30) |
| InChIKey | DYXPJFMFEIGVHM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|