C17H23FN4O2S — CID 139799553
1-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea (PubChem CID 139799553) has the molecular formula C17H23FN4O2S and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea.
| Compound Name | 1-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 139799553 |
| Molecular Formula | C17H23FN4O2S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
| SMILES | CNC(=S)NC[C@H]1CN(c2ccc(N3CCCCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN4O2S/c1-19-16(25)20-10-13-11-22(17(23)24-13)12-5-6-15(14(18)9-12)21-7-3-2-4-8-21/h5-6,9,13H,2-4,7-8,10-11H2,1H3,(H2,19,20,25)/t13-/m0/s1 |
| InChIKey | AWRMODGXETZNHI-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|