C20H26FN3O2S2 — CID 18619435
N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopentanecarbothioamide (PubChem CID 18619435) has the molecular formula C20H26FN3O2S2 and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopentanecarbothioamide.
| Compound Name | N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopentanecarbothioamide |
|---|---|
| PubChem CID | 18619435 |
| Molecular Formula | C20H26FN3O2S2 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopentanecarbothioamide |
| SMILES | O=C1OC(CNC(=S)C2CCCC2)CN1c1ccc(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C20H26FN3O2S2/c21-17-11-15(5-6-18(17)23-7-9-28-10-8-23)24-13-16(26-20(24)25)12-22-19(27)14-3-1-2-4-14/h5-6,11,14,16H,1-4,7-10,12-13H2,(H,22,27) |
| InChIKey | LRNRBJCQBFDJMN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|