C18H24FN3O2S2 — CID 22624094
N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]butanethioamide (PubChem CID 22624094) has the molecular formula C18H24FN3O2S2 and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]butanethioamide.
| Compound Name | N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]butanethioamide |
|---|---|
| PubChem CID | 22624094 |
| Molecular Formula | C18H24FN3O2S2 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]butanethioamide |
| SMILES | CCCC(=S)NCC1CN(c2ccc(N3CCSCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24FN3O2S2/c1-2-3-17(25)20-11-14-12-22(18(23)24-14)13-4-5-16(15(19)10-13)21-6-8-26-9-7-21/h4-5,10,14H,2-3,6-9,11-12H2,1H3,(H,20,25) |
| InChIKey | MTYUPJXHRCKNIQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|