C15H19FN2O3S — CID 10806051
(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(2-hydroxyethyl)-1,3-oxazolidin-2-one (PubChem CID 10806051) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(2-hydroxyethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(2-hydroxyethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10806051 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(2-hydroxyethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CCO)CN1c1ccc(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C15H19FN2O3S/c16-13-9-11(18-10-12(3-6-19)21-15(18)20)1-2-14(13)17-4-7-22-8-5-17/h1-2,9,12,19H,3-8,10H2/t12-/m0/s1 |
| InChIKey | XKKFAUOBEZJNJF-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|