C14H17FN2O4S — CID 22943616
3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 22943616) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22943616 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CO)CN1c1ccc(N2CCS(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C14H17FN2O4S/c15-12-7-10(17-8-11(9-18)21-14(17)19)1-2-13(12)16-3-5-22(20)6-4-16/h1-2,7,11,18H,3-6,8-9H2 |
| InChIKey | KZVIVNXINUQBKV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|