C20H30FN3O4S — CID 91488741
acetonitrile;(5S)-5-ethyl-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-1,3-oxazolidin-2-one;propan-2-ol (PubChem CID 91488741) has the molecular formula C20H30FN3O4S and a molecular weight of 427.54 g/mol. Its IUPAC name is acetonitrile;(5S)-5-ethyl-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-1,3-oxazolidin-2-one;propan-2-ol.
| Compound Name | acetonitrile;(5S)-5-ethyl-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-1,3-oxazolidin-2-one;propan-2-ol |
|---|---|
| PubChem CID | 91488741 |
| Molecular Formula | C20H30FN3O4S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | acetonitrile;(5S)-5-ethyl-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-1,3-oxazolidin-2-one;propan-2-ol |
| SMILES | CC#N.CC(C)O.CC[C@H]1CN(c2ccc(N3CCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H19FN2O3S.C3H8O.C2H3N/c1-2-12-10-18(15(19)21-12)11-3-4-14(13(16)9-11)17-5-7-22(20)8-6-17;1-3(2)4;1-2-3/h3-4,9,12H,2,5-8,10H2,1H3;3-4H,1-2H3;1H3/t12-;;/m0../s1 |
| InChIKey | KBTFIYCUGXAUQT-LTCKWSDVSA-N |
| XLogP | 3.05 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|