C17H25FN2O7 — CID 143914751
ethane;5-ethyl-3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 143914751) has the molecular formula C17H25FN2O7 and a molecular weight of 388.39 g/mol. Its IUPAC name is ethane;5-ethyl-3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-ethyl-3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143914751 |
| Molecular Formula | C17H25FN2O7 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethane;5-ethyl-3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC.CCC1CN(c2ccc(N3CC(O)(O)OC(O)(O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H19FN2O7.C2H6/c1-2-10-6-18(13(19)24-10)9-3-4-12(11(16)5-9)17-7-14(20,21)25-15(22,23)8-17;1-2/h3-5,10,20-23H,2,6-8H2,1H3;1-2H3 |
| InChIKey | MSPZBNJBXKJXCF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|