C16H19BFN3O9 — CID 145494795
CID 145494795 (PubChem CID 145494795) has the molecular formula C16H19BFN3O9 and a molecular weight of 427.15 g/mol.
| Compound Name | CID 145494795 |
|---|---|
| PubChem CID | 145494795 |
| Molecular Formula | C16H19BFN3O9 |
| Molecular Weight | 427.15 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | — |
| SMILES | [B]C1(O)CN(c2ccc(N3CC(C(O)(O)NC(C)=O)OC3=O)cc2F)CC(O)(O)O1 |
| InChI | InChI=1S/C16H19BFN3O9/c1-8(22)19-16(27,28)12-5-21(13(23)29-12)9-2-3-11(10(18)4-9)20-6-14(17,24)30-15(25,26)7-20/h2-4,12,24-28H,5-7H2,1H3,(H,19,22) |
| InChIKey | JRLWSYNDXNAQPK-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 172.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.15 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|