C17H24FN3O8 — CID 145494793
ethane;N-[[3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 145494793) has the molecular formula C17H24FN3O8 and a molecular weight of 417.39 g/mol. Its IUPAC name is ethane;N-[[3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | ethane;N-[[3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 145494793 |
| Molecular Formula | C17H24FN3O8 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | ethane;N-[[3-[3-fluoro-4-(2,2,6,6-tetrahydroxymorpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | CC.O=CNCC1CN(c2ccc(N3CC(O)(O)OC(O)(O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H18FN3O8.C2H6/c16-11-3-9(19-5-10(4-17-8-20)26-13(19)21)1-2-12(11)18-6-14(22,23)27-15(24,25)7-18;1-2/h1-3,8,10,22-25H,4-7H2,(H,17,20);1-2H3 |
| InChIKey | QKGQDRKXXDOGNL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|