C11H10FN5O3 — CID 89363600
N-[[(5S)-3-(4-azido-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 89363600) has the molecular formula C11H10FN5O3 and a molecular weight of 279.23 g/mol. Its IUPAC name is N-[[(5S)-3-(4-azido-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | N-[[(5S)-3-(4-azido-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 89363600 |
| Molecular Formula | C11H10FN5O3 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[[(5S)-3-(4-azido-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | [N-]=[N+]=Nc1ccc(N2C[C@H](CNC=O)OC2=O)cc1F |
| InChI | InChI=1S/C11H10FN5O3/c12-9-3-7(1-2-10(9)15-16-13)17-5-8(4-14-6-18)20-11(17)19/h1-3,6,8H,4-5H2,(H,14,18)/t8-/m0/s1 |
| InChIKey | LYUFCOLVBWJZRI-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|