C19H16FN5O3 — CID 141421402
N-[[3-[3-fluoro-4-(4-pyridin-2-yl-1H-pyrazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 141421402) has the molecular formula C19H16FN5O3 and a molecular weight of 381.37 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-(4-pyridin-2-yl-1H-pyrazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | N-[[3-[3-fluoro-4-(4-pyridin-2-yl-1H-pyrazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 141421402 |
| Molecular Formula | C19H16FN5O3 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[[3-[3-fluoro-4-(4-pyridin-2-yl-1H-pyrazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | O=CNCC1CN(c2ccc(-c3[nH]ncc3-c3ccccn3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H16FN5O3/c20-16-7-12(25-10-13(8-21-11-26)28-19(25)27)4-5-14(16)18-15(9-23-24-18)17-3-1-2-6-22-17/h1-7,9,11,13H,8,10H2,(H,21,26)(H,23,24) |
| InChIKey | CXDYVVPOVKKQFR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|