C23H22FN5O3 — CID 142270595
N-[[3-[4-(2-benzyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 142270595) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[[3-[4-(2-benzyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | N-[[3-[4-(2-benzyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 142270595 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[[3-[4-(2-benzyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | O=CNCC1CN(c2ccc(N3Cc4cn(Cc5ccccc5)nc4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H22FN5O3/c24-20-8-18(29-13-19(9-25-15-30)32-23(29)31)6-7-22(20)27-11-17-12-28(26-21(17)14-27)10-16-4-2-1-3-5-16/h1-8,12,15,19H,9-11,13-14H2,(H,25,30) |
| InChIKey | RHDJNSYMUYSVAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|