C19H23FN5O7P — CID 21354609
2-[5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]ethyl dihydrogen phosphate (PubChem CID 21354609) has the molecular formula C19H23FN5O7P and a molecular weight of 483.39 g/mol. Its IUPAC name is 2-[5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 21354609 |
| Molecular Formula | C19H23FN5O7P |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]ethyl dihydrogen phosphate |
| SMILES | CC(=O)NCC1CN(c2ccc(N3Cc4cn(CCOP(=O)(O)O)nc4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H23FN5O7P/c1-12(26)21-7-15-10-25(19(27)32-15)14-2-3-18(16(20)6-14)23-8-13-9-24(22-17(13)11-23)4-5-31-33(28,29)30/h2-3,6,9,15H,4-5,7-8,10-11H2,1H3,(H,21,26)(H2,28,29,30) |
| InChIKey | BPXHUSBPWAJRRE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|