C19H20FN3O2 — CID 23394079
5-(aminomethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 23394079) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-(aminomethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23394079 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-(aminomethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | NCC1CN(c2ccc(N3CCc4ccccc4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H20FN3O2/c20-17-9-15(23-12-16(10-21)25-19(23)24)5-6-18(17)22-8-7-13-3-1-2-4-14(13)11-22/h1-6,9,16H,7-8,10-12,21H2 |
| InChIKey | XZJGSJMMVQHJHX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|