C17H17FN4O2 — CID 22087045
5-(aminomethyl)-3-[4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 22087045) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 5-(aminomethyl)-3-[4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-[4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22087045 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-(aminomethyl)-3-[4-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)-3-fluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | NCC1CN(c2ccc(N3Cc4ccncc4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H17FN4O2/c18-15-5-13(22-10-14(6-19)24-17(22)23)1-2-16(15)21-8-11-3-4-20-7-12(11)9-21/h1-5,7,14H,6,8-10,19H2 |
| InChIKey | NNIOSXWXJBHVIU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|