C15H21FN4O3 — CID 91132691
(5S)-5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one;formaldehyde (PubChem CID 91132691) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one;formaldehyde.
| Compound Name | (5S)-5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one;formaldehyde |
|---|---|
| PubChem CID | 91132691 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one;formaldehyde |
| SMILES | C=O.NC[C@H]1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H19FN4O2.CH2O/c15-12-7-10(19-9-11(8-16)21-14(19)20)1-2-13(12)18-5-3-17-4-6-18;1-2/h1-2,7,11,17H,3-6,8-9,16H2;1H2/t11-;/m0./s1 |
| InChIKey | ZDUMMFGUVBFTNO-MERQFXBCSA-N |
| XLogP | 0.33 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|