C20H29FN4O5 — CID 91500548
tert-butyl N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate;formaldehyde (PubChem CID 91500548) has the molecular formula C20H29FN4O5 and a molecular weight of 424.47 g/mol. Its IUPAC name is tert-butyl N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate;formaldehyde.
| Compound Name | tert-butyl N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate;formaldehyde |
|---|---|
| PubChem CID | 91500548 |
| Molecular Formula | C20H29FN4O5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate;formaldehyde |
| SMILES | C=O.CC(C)(C)OC(=O)NC[C@H]1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H27FN4O4.CH2O/c1-19(2,3)28-17(25)22-11-14-12-24(18(26)27-14)13-4-5-16(15(20)10-13)23-8-6-21-7-9-23;1-2/h4-5,10,14,21H,6-9,11-12H2,1-3H3,(H,22,25);1H2/t14-;/m0./s1 |
| InChIKey | XIMXSLJKCFYQOV-UQKRIMTDSA-N |
| XLogP | 1.90 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|