C20H30FN5O3 — CID 10069965
2-amino-N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-methylpentanamide (PubChem CID 10069965) has the molecular formula C20H30FN5O3 and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-amino-N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10069965 |
| Molecular Formula | C20H30FN5O3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-amino-N-[[(5S)-3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NC[C@H]1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H30FN5O3/c1-13(2)9-17(22)19(27)24-11-15-12-26(20(28)29-15)14-3-4-18(16(21)10-14)25-7-5-23-6-8-25/h3-4,10,13,15,17,23H,5-9,11-12,22H2,1-2H3,(H,24,27)/t15-,17?/m0/s1 |
| InChIKey | YQDACVSRKSQAED-MYJWUSKBSA-N |
| XLogP | 1.05 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|