C16H23FN4O9P2 — CID 91384823
[2-[[3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxo-1-phosphonoethyl]phosphonic acid (PubChem CID 91384823) has the molecular formula C16H23FN4O9P2 and a molecular weight of 496.33 g/mol. Its IUPAC name is [2-[[3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxo-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[[3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxo-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 91384823 |
| Molecular Formula | C16H23FN4O9P2 |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [2-[[3-(3-fluoro-4-piperazin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxo-1-phosphonoethyl]phosphonic acid |
| SMILES | O=C(NCC1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C16H23FN4O9P2/c17-12-7-10(1-2-13(12)20-5-3-18-4-6-20)21-9-11(30-16(21)23)8-19-14(22)15(31(24,25)26)32(27,28)29/h1-2,7,11,15,18H,3-6,8-9H2,(H,19,22)(H2,24,25,26)(H2,27,28,29) |
| InChIKey | QVGOUSQFRCBZQV-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 188.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|