C23H28FN3O10P2 — CID 25029441
[2-[4-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl]phenyl]-1-phosphonoethyl]phosphonic acid (PubChem CID 25029441) has the molecular formula C23H28FN3O10P2 and a molecular weight of 587.43 g/mol. Its IUPAC name is [2-[4-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl]phenyl]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[4-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl]phenyl]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25029441 |
| Molecular Formula | C23H28FN3O10P2 |
| Molecular Weight | 587.43 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | [2-[4-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl]phenyl]-1-phosphonoethyl]phosphonic acid |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1)c1ccc(CC(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C23H28FN3O10P2/c24-19-12-17(5-6-20(19)26-7-9-36-10-8-26)27-14-18(37-23(27)29)13-25-22(28)16-3-1-15(2-4-16)11-21(38(30,31)32)39(33,34)35/h1-6,12,18,21H,7-11,13-14H2,(H,25,28)(H2,30,31,32)(H2,33,34,35)/t18-/m0/s1 |
| InChIKey | AQBXUKWHIKOZKQ-SFHVURJKSA-N |
| XLogP | 1.64 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|