C18H22FN3O6 — CID 22943686
methyl 3-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-3-oxopropanoate (PubChem CID 22943686) has the molecular formula C18H22FN3O6 and a molecular weight of 395.39 g/mol. Its IUPAC name is methyl 3-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-3-oxopropanoate.
| Compound Name | methyl 3-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 22943686 |
| Molecular Formula | C18H22FN3O6 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | methyl 3-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)NCC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H22FN3O6/c1-26-17(24)9-16(23)20-10-13-11-22(18(25)28-13)12-2-3-15(14(19)8-12)21-4-6-27-7-5-21/h2-3,8,13H,4-7,9-11H2,1H3,(H,20,23) |
| InChIKey | HEHSYFXIFNFCPD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|