C18H26FN3O5Si — CID 90213724
N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-[hydroxy(dimethyl)silyl]acetamide (PubChem CID 90213724) has the molecular formula C18H26FN3O5Si and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-[hydroxy(dimethyl)silyl]acetamide.
| Compound Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-[hydroxy(dimethyl)silyl]acetamide |
|---|---|
| PubChem CID | 90213724 |
| Molecular Formula | C18H26FN3O5Si |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-[hydroxy(dimethyl)silyl]acetamide |
| SMILES | C[Si](C)(O)CC(=O)NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H26FN3O5Si/c1-28(2,25)12-17(23)20-10-14-11-22(18(24)27-14)13-3-4-16(15(19)9-13)21-5-7-26-8-6-21/h3-4,9,14,25H,5-8,10-12H2,1-2H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | DQALVMBSLQXOAX-AWEZNQCLSA-N |
| XLogP | 1.30 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|