C16H21Cl2FN6O2 — CID 69364107
(5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one;dihydrochloride (PubChem CID 69364107) has the molecular formula C16H21Cl2FN6O2 and a molecular weight of 419.29 g/mol. Its IUPAC name is (5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one;dihydrochloride.
| Compound Name | (5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 69364107 |
| Molecular Formula | C16H21Cl2FN6O2 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (5R)-3-(3-fluoro-4-piperazin-1-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1O[C@@H](Cn2ccnn2)CN1c1ccc(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C16H19FN6O2.2ClH/c17-14-9-12(1-2-15(14)21-6-3-18-4-7-21)23-11-13(25-16(23)24)10-22-8-5-19-20-22;;/h1-2,5,8-9,13,18H,3-4,6-7,10-11H2;2*1H/t13-;;/m0../s1 |
| InChIKey | BWRJVWBRNOJCEC-GXKRWWSZSA-N |
| XLogP | 1.70 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|