C17H21FN8O2 — CID 71472776
4-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboximidamide (PubChem CID 71472776) has the molecular formula C17H21FN8O2 and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboximidamide.
| Compound Name | 4-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 71472776 |
| Molecular Formula | C17H21FN8O2 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(c2ccc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C17H21FN8O2/c18-14-9-12(1-2-15(14)23-5-7-24(8-6-23)16(19)20)26-11-13(28-17(26)27)10-25-4-3-21-22-25/h1-4,9,13H,5-8,10-11H2,(H3,19,20)/t13-/m0/s1 |
| InChIKey | GSVKZCCDMBTFLO-ZDUSSCGKSA-N |
| XLogP | 0.46 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|