C14H18FN7O2 — CID 76734453
3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 76734453) has the molecular formula C14H18FN7O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 76734453 |
| Molecular Formula | C14H18FN7O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | NNCCNc1ccc(N2CC(Cn3ccnn3)OC2=O)cc1F |
| InChI | InChI=1S/C14H18FN7O2/c15-12-7-10(1-2-13(12)17-3-4-18-16)22-9-11(24-14(22)23)8-21-6-5-19-20-21/h1-2,5-7,11,17-18H,3-4,8-9,16H2 |
| InChIKey | YZQTWAFRDKUAKV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|