C13H20FN5O2 — CID 58361744
(5S)-3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one (PubChem CID 58361744) has the molecular formula C13H20FN5O2 and a molecular weight of 297.33 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58361744 |
| Molecular Formula | C13H20FN5O2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (5S)-3-[3-fluoro-4-(2-hydrazinylethylamino)phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
| SMILES | CNC[C@H]1CN(c2ccc(NCCNN)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C13H20FN5O2/c1-16-7-10-8-19(13(20)21-10)9-2-3-12(11(14)6-9)17-4-5-18-15/h2-3,6,10,16-18H,4-5,7-8,15H2,1H3/t10-/m0/s1 |
| InChIKey | PLRZVCKNKMZBDJ-JTQLQIEISA-N |
| XLogP | 0.25 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|