C22H21FN4O6 — CID 58361767
N-[[(5S)-3-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 58361767) has the molecular formula C22H21FN4O6 and a molecular weight of 456.43 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58361767 |
| Molecular Formula | C22H21FN4O6 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[[(5S)-3-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NCCON3C(=O)c4ccccc4C3=O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H21FN4O6/c1-13(28)25-11-15-12-26(22(31)33-15)14-6-7-19(18(23)10-14)24-8-9-32-27-20(29)16-4-2-3-5-17(16)21(27)30/h2-7,10,15,24H,8-9,11-12H2,1H3,(H,25,28)/t15-/m0/s1 |
| InChIKey | FGWUOEVUZOUYIG-HNNXBMFYSA-N |
| XLogP | 1.93 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|