C19H26FN5O5 — CID 163813481
N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]morpholine-4-carboxamide (PubChem CID 163813481) has the molecular formula C19H26FN5O5 and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 163813481 |
| Molecular Formula | C19H26FN5O5 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]morpholine-4-carboxamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NCCNC(=O)N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H26FN5O5/c1-13(26)23-11-15-12-25(19(28)30-15)14-2-3-17(16(20)10-14)21-4-5-22-18(27)24-6-8-29-9-7-24/h2-3,10,15,21H,4-9,11-12H2,1H3,(H,22,27)(H,23,26)/t15-/m0/s1 |
| InChIKey | NPHKYIWZZMXAIU-HNNXBMFYSA-N |
| XLogP | 0.74 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|