C24H28FN5O5 — CID 71083915
N-[[(5S)-3-[4-[4-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 71083915) has the molecular formula C24H28FN5O5 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[4-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 71083915 |
| Molecular Formula | C24H28FN5O5 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCC(=C(C#N)C(=O)N4CCOCC4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H28FN5O5/c1-16(31)27-14-19-15-30(24(33)35-19)18-2-3-22(21(25)12-18)28-6-4-17(5-7-28)20(13-26)23(32)29-8-10-34-11-9-29/h2-3,12,19H,4-11,14-15H2,1H3,(H,27,31)/t19-/m0/s1 |
| InChIKey | MVTCONAMSGIWLF-IBGZPJMESA-N |
| XLogP | 1.57 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|