C24H24FN5O3 — CID 69310459
N-[[3-[4-[4-[cyano(pyridin-2-yl)methylidene]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 69310459) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[[3-[4-[4-[cyano(pyridin-2-yl)methylidene]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-[cyano(pyridin-2-yl)methylidene]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 69310459 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[[3-[4-[4-[cyano(pyridin-2-yl)methylidene]piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCC(=C(C#N)c4ccccn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H24FN5O3/c1-16(31)28-14-19-15-30(24(32)33-19)18-5-6-23(21(25)12-18)29-10-7-17(8-11-29)20(13-26)22-4-2-3-9-27-22/h2-6,9,12,19H,7-8,10-11,14-15H2,1H3,(H,28,31) |
| InChIKey | WVGBONSLKGPWOQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|