C15H21FN2O3P- — CID 90929049
3-[4-(2-ethoxyethylamino)-3-fluorophenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 90929049) has the molecular formula C15H21FN2O3P- and a molecular weight of 327.32 g/mol. Its IUPAC name is 3-[4-(2-ethoxyethylamino)-3-fluorophenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(2-ethoxyethylamino)-3-fluorophenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90929049 |
| Molecular Formula | C15H21FN2O3P- |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[4-(2-ethoxyethylamino)-3-fluorophenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | C[CH-]OCCNc1ccc(N2CC(CPC)OC2=O)cc1F |
| InChI | InChI=1S/C15H21FN2O3P/c1-3-20-7-6-17-14-5-4-11(8-13(14)16)18-9-12(10-22-2)21-15(18)19/h3-5,8,12,17,22H,6-7,9-10H2,1-2H3/q-1 |
| InChIKey | AXUKICDTIYZYDK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|