C15H22FN2O2P — CID 58361782
(5R)-3-[3-fluoro-4-[methyl(propyl)amino]phenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 58361782) has the molecular formula C15H22FN2O2P and a molecular weight of 312.33 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-[methyl(propyl)amino]phenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-[methyl(propyl)amino]phenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58361782 |
| Molecular Formula | C15H22FN2O2P |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (5R)-3-[3-fluoro-4-[methyl(propyl)amino]phenyl]-5-(methylphosphanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCN(C)c1ccc(N2C[C@H](CPC)OC2=O)cc1F |
| InChI | InChI=1S/C15H22FN2O2P/c1-4-7-17(2)14-6-5-11(8-13(14)16)18-9-12(10-21-3)20-15(18)19/h5-6,8,12,21H,4,7,9-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | ATGNVMGVMGANHW-GFCCVEGCSA-N |
| XLogP | 3.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|