C17H21FN3O3+ — CID 91428391
N-[[3-[4-[ethenyl(propyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 91428391) has the molecular formula C17H21FN3O3+ and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[[3-[4-[ethenyl(propyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[ethenyl(propyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91428391 |
| Molecular Formula | C17H21FN3O3+ |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-[[3-[4-[ethenyl(propyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/[C+]=C/N(CCC)c1ccc(N2CC(CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C17H20FN3O3/c1-4-8-20(5-2)16-7-6-13(9-15(16)18)21-11-14(24-17(21)23)10-19-12(3)22/h2,5-7,9,14H,4,8,10-11H2,1,3H3/p+1 |
| InChIKey | CTWLEMFISBNHOD-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|