C17H25FN6O5S — CID 90810755
N-[[3-[4-[2-(dimethylsulfamoylamino)ethyl-methanimidoylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 90810755) has the molecular formula C17H25FN6O5S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[[3-[4-[2-(dimethylsulfamoylamino)ethyl-methanimidoylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[2-(dimethylsulfamoylamino)ethyl-methanimidoylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 90810755 |
| Molecular Formula | C17H25FN6O5S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[[3-[4-[2-(dimethylsulfamoylamino)ethyl-methanimidoylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N(CCNS(=O)(=O)N(C)C)c1ccc(N2CC(CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C17H25FN6O5S/c1-12(25)20-9-14-10-24(17(26)29-14)13-4-5-16(15(18)8-13)23(11-19)7-6-21-30(27,28)22(2)3/h4-5,8,11,14,19,21H,6-7,9-10H2,1-3H3,(H,20,25)/b19-11+ |
| InChIKey | MJKSZWQBPVXVBU-YBFXNURJSA-N |
| XLogP | 0.10 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|