C18H20F3N5O3 — CID 91587813
2,2-difluoro-N-[[3-[3-fluoro-4-[methanimidoyl-[2-(prop-2-ynylamino)ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 91587813) has the molecular formula C18H20F3N5O3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 2,2-difluoro-N-[[3-[3-fluoro-4-[methanimidoyl-[2-(prop-2-ynylamino)ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[[3-[3-fluoro-4-[methanimidoyl-[2-(prop-2-ynylamino)ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91587813 |
| Molecular Formula | C18H20F3N5O3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2,2-difluoro-N-[[3-[3-fluoro-4-[methanimidoyl-[2-(prop-2-ynylamino)ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N(CCNCC#C)c1ccc(N2CC(CNC(=O)C(F)F)OC2=O)cc1F |
| InChI | InChI=1S/C18H20F3N5O3/c1-2-5-23-6-7-25(11-22)15-4-3-12(8-14(15)19)26-10-13(29-18(26)28)9-24-17(27)16(20)21/h1,3-4,8,11,13,16,22-23H,5-7,9-10H2,(H,24,27)/b22-11+ |
| InChIKey | UHBFPPKSJAMKNF-SSDVNMTOSA-N |
| XLogP | 1.17 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|