C15H19F2N5O3 — CID 89083126
N-[[3-[4-[2-aminoethyl(methanimidoyl)amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 89083126) has the molecular formula C15H19F2N5O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[[3-[4-[2-aminoethyl(methanimidoyl)amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[2-aminoethyl(methanimidoyl)amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 89083126 |
| Molecular Formula | C15H19F2N5O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[[3-[4-[2-aminoethyl(methanimidoyl)amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N(CCN)c1c(F)cc(N2CC(CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C15H19F2N5O3/c1-9(23)20-6-11-7-22(15(24)25-11)10-4-12(16)14(13(17)5-10)21(8-19)3-2-18/h4-5,8,11,19H,2-3,6-7,18H2,1H3,(H,20,23)/b19-8+ |
| InChIKey | LKDQOBKCOXAOPQ-UFWORHAWSA-N |
| XLogP | 0.80 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|