C19H24F2N8O5 — CID 143551816
N-[[3-[4-[2-[2-[diazenyl(methanimidoyl)amino]acetyl]-1,2,5-oxadiazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 143551816) has the molecular formula C19H24F2N8O5 and a molecular weight of 482.45 g/mol. Its IUPAC name is N-[[3-[4-[2-[2-[diazenyl(methanimidoyl)amino]acetyl]-1,2,5-oxadiazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[2-[2-[diazenyl(methanimidoyl)amino]acetyl]-1,2,5-oxadiazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143551816 |
| Molecular Formula | C19H24F2N8O5 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[[3-[4-[2-[2-[diazenyl(methanimidoyl)amino]acetyl]-1,2,5-oxadiazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N(CC(=O)N1CCN(c2c(F)cc(N3CC(CNC(C)=O)OC3=O)cc2F)CCO1)/N=N/[H] |
| InChI | InChI=1S/C19H24F2N8O5/c1-12(30)24-8-14-9-28(19(32)34-14)13-6-15(20)18(16(21)7-13)26-2-3-29(33-5-4-26)17(31)10-27(11-22)25-23/h6-7,11,14,22-23H,2-5,8-10H2,1H3,(H,24,30)/b22-11+,25-23+ |
| InChIKey | UWHZLEYPWDPKJC-UZHLFBRFSA-N |
| XLogP | 0.86 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|