C21H26F3N3O5 — CID 161202931
(5S)-3-[3,5-difluoro-4-[2-(4-fluorobutanoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 161202931) has the molecular formula C21H26F3N3O5 and a molecular weight of 457.45 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-[2-(4-fluorobutanoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-[2-(4-fluorobutanoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 161202931 |
| Molecular Formula | C21H26F3N3O5 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-[2-(4-fluorobutanoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2cc(F)c(N3CCON(C(=O)CCCF)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H26F3N3O5/c1-14(28)4-5-16-13-26(21(30)32-16)15-11-17(23)20(18(24)12-15)25-7-8-27(31-10-9-25)19(29)3-2-6-22/h11-12,16H,2-10,13H2,1H3/t16-/m0/s1 |
| InChIKey | UVFKSSTYYIGYAM-INIZCTEOSA-N |
| XLogP | 2.99 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|