C18H22F2N4O6S — CID 160913141
O-methyl 3-[(5S)-3-[3,5-difluoro-4-[2-(hydroxycarbamoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate (PubChem CID 160913141) has the molecular formula C18H22F2N4O6S and a molecular weight of 460.46 g/mol. Its IUPAC name is O-methyl 3-[(5S)-3-[3,5-difluoro-4-[2-(hydroxycarbamoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate.
| Compound Name | O-methyl 3-[(5S)-3-[3,5-difluoro-4-[2-(hydroxycarbamoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
|---|---|
| PubChem CID | 160913141 |
| Molecular Formula | C18H22F2N4O6S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | O-methyl 3-[(5S)-3-[3,5-difluoro-4-[2-(hydroxycarbamoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
| SMILES | COC(=S)CC[C@H]1CN(c2cc(F)c(N3CCON(C(=O)NO)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H22F2N4O6S/c1-28-15(31)3-2-12-10-23(18(26)30-12)11-8-13(19)16(14(20)9-11)22-4-5-24(17(25)21-27)29-7-6-22/h8-9,12,27H,2-7,10H2,1H3,(H,21,25)/t12-/m0/s1 |
| InChIKey | SRBCLBTYTSGNRZ-LBPRGKRZSA-N |
| XLogP | 2.20 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|