C21H24F2N6O4S2 — CID 147642901
O-methyl 3-[(5S)-3-[3,5-difluoro-4-[1-[2-(1,3,4-thiadiazol-2-yl)acetyl]-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate (PubChem CID 147642901) has the molecular formula C21H24F2N6O4S2 and a molecular weight of 526.59 g/mol. Its IUPAC name is O-methyl 3-[(5S)-3-[3,5-difluoro-4-[1-[2-(1,3,4-thiadiazol-2-yl)acetyl]-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate.
| Compound Name | O-methyl 3-[(5S)-3-[3,5-difluoro-4-[1-[2-(1,3,4-thiadiazol-2-yl)acetyl]-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
|---|---|
| PubChem CID | 147642901 |
| Molecular Formula | C21H24F2N6O4S2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | O-methyl 3-[(5S)-3-[3,5-difluoro-4-[1-[2-(1,3,4-thiadiazol-2-yl)acetyl]-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
| SMILES | COC(=S)CC[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)Cc4nncs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H24F2N6O4S2/c1-32-19(34)3-2-14-11-28(21(31)33-14)13-8-15(22)20(16(23)9-13)27-5-4-25-29(7-6-27)18(30)10-17-26-24-12-35-17/h8-9,12,14,25H,2-7,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | GHZAFYFXPHGHHY-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|