C23H30F4N6O4 — CID 162194028
(5S)-3-[3,5-difluoro-4-[1-(4-methylpiperazine-1-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 162194028) has the molecular formula C23H30F4N6O4 and a molecular weight of 530.52 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-[1-(4-methylpiperazine-1-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-[1-(4-methylpiperazine-1-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162194028 |
| Molecular Formula | C23H30F4N6O4 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-[1-(4-methylpiperazine-1-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CN1CCN(C(=O)N2CCN(c3c(F)cc(N4C[C@H](CCC(=O)C(F)F)OC4=O)cc3F)CCN2)CC1 |
| InChI | InChI=1S/C23H30F4N6O4/c1-29-6-8-31(9-7-29)22(35)33-11-10-30(5-4-28-33)20-17(24)12-15(13-18(20)25)32-14-16(37-23(32)36)2-3-19(34)21(26)27/h12-13,16,21,28H,2-11,14H2,1H3/t16-/m0/s1 |
| InChIKey | ZQRXVKUSNCHCSA-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|