C17H21F2N3O5 — CID 158499557
methyl 3-[(5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanoate (PubChem CID 158499557) has the molecular formula C17H21F2N3O5 and a molecular weight of 385.37 g/mol. Its IUPAC name is methyl 3-[(5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanoate.
| Compound Name | methyl 3-[(5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanoate |
|---|---|
| PubChem CID | 158499557 |
| Molecular Formula | C17H21F2N3O5 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | methyl 3-[(5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CN(c2cc(F)c(N3CCNOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H21F2N3O5/c1-25-15(23)3-2-12-10-22(17(24)27-12)11-8-13(18)16(14(19)9-11)21-5-4-20-26-7-6-21/h8-9,12,20H,2-7,10H2,1H3/t12-/m0/s1 |
| InChIKey | HJSJJALCVMHUOX-LBPRGKRZSA-N |
| XLogP | 1.58 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|