C16H26F2N8O3 — CID 143785281
(5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-[(hydrazinylmethylamino)methyl]-1,3-oxazolidin-2-one;methylidenehydrazine (PubChem CID 143785281) has the molecular formula C16H26F2N8O3 and a molecular weight of 416.43 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-[(hydrazinylmethylamino)methyl]-1,3-oxazolidin-2-one;methylidenehydrazine.
| Compound Name | (5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-[(hydrazinylmethylamino)methyl]-1,3-oxazolidin-2-one;methylidenehydrazine |
|---|---|
| PubChem CID | 143785281 |
| Molecular Formula | C16H26F2N8O3 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-[(hydrazinylmethylamino)methyl]-1,3-oxazolidin-2-one;methylidenehydrazine |
| SMILES | C=NN.NNCNC[C@H]1CN(c2cc(F)c(N3CCNOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H22F2N6O3.CH4N2/c16-12-5-10(23-8-11(26-15(23)24)7-19-9-20-18)6-13(17)14(12)22-2-1-21-25-4-3-22;1-3-2/h5-6,11,19-21H,1-4,7-9,18H2;1-2H2/t11-;/m0./s1 |
| InChIKey | GQWBPPOZSOEJPO-MERQFXBCSA-N |
| XLogP | -0.80 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|