C17H23F2N3O4S — CID 166748430
N-[[(5S)-3-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;methanol (PubChem CID 166748430) has the molecular formula C17H23F2N3O4S and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[[(5S)-3-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;methanol.
| Compound Name | N-[[(5S)-3-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;methanol |
|---|---|
| PubChem CID | 166748430 |
| Molecular Formula | C17H23F2N3O4S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[(5S)-3-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;methanol |
| SMILES | CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCSCC3)c(F)c2)C(=O)O1.CO |
| InChI | InChI=1S/C16H19F2N3O3S.CH4O/c1-10(22)19-8-12-9-21(16(23)24-12)11-6-13(17)15(14(18)7-11)20-2-4-25-5-3-20;1-2/h6-7,12H,2-5,8-9H2,1H3,(H,19,22);2H,1H3/t12-;/m0./s1 |
| InChIKey | UPBKVHALYOJXPD-YDALLXLXSA-N |
| XLogP | 1.59 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|