C22H23F3N3O4P — CID 25006795
N-[[(5S)-3-[3,5-difluoro-4-[4-(4-fluorophenyl)-4-oxo-1,4λ5-azaphosphinan-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 25006795) has the molecular formula C22H23F3N3O4P and a molecular weight of 481.41 g/mol. Its IUPAC name is N-[[(5S)-3-[3,5-difluoro-4-[4-(4-fluorophenyl)-4-oxo-1,4λ5-azaphosphinan-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3,5-difluoro-4-[4-(4-fluorophenyl)-4-oxo-1,4λ5-azaphosphinan-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 25006795 |
| Molecular Formula | C22H23F3N3O4P |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[[(5S)-3-[3,5-difluoro-4-[4-(4-fluorophenyl)-4-oxo-1,4λ5-azaphosphinan-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCP(=O)(c4ccc(F)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H23F3N3O4P/c1-14(29)26-12-17-13-28(22(30)32-17)16-10-19(24)21(20(25)11-16)27-6-8-33(31,9-7-27)18-4-2-15(23)3-5-18/h2-5,10-11,17H,6-9,12-13H2,1H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | UXANMGBUTYGKGK-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|