C17H21F2N5O4 — CID 155319476
N-[[(5S)-3-[4-[3-(carbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 155319476) has the molecular formula C17H21F2N5O4 and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[3-(carbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[3-(carbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 155319476 |
| Molecular Formula | C17H21F2N5O4 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[[(5S)-3-[4-[3-(carbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCC(NC(N)=O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H21F2N5O4/c1-9(25)21-6-12-8-24(17(27)28-12)11-4-13(18)15(14(19)5-11)23-3-2-10(7-23)22-16(20)26/h4-5,10,12H,2-3,6-8H2,1H3,(H,21,25)(H3,20,22,26)/t10?,12-/m0/s1 |
| InChIKey | QTIJWIGLIVPQFS-KFJBMODSSA-N |
| XLogP | 0.67 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|