C17H22F2N4O3 — CID 68943046
N-[[(5S)-3-[4-(4-aminopiperidin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 68943046) has the molecular formula C17H22F2N4O3 and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(4-aminopiperidin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-(4-aminopiperidin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 68943046 |
| Molecular Formula | C17H22F2N4O3 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[[(5S)-3-[4-(4-aminopiperidin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCC(N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H22F2N4O3/c1-10(24)21-8-13-9-23(17(25)26-13)12-6-14(18)16(15(19)7-12)22-4-2-11(20)3-5-22/h6-7,11,13H,2-5,8-9,20H2,1H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | AZMXUHFUXGGPCE-ZDUSSCGKSA-N |
| XLogP | 1.35 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|