C18H23F2N3O2S — CID 135148473
(5S)-5-[(cyclopropylamino)methyl]-3-[3,5-difluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 135148473) has the molecular formula C18H23F2N3O2S and a molecular weight of 383.46 g/mol. Its IUPAC name is (5S)-5-[(cyclopropylamino)methyl]-3-[3,5-difluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[(cyclopropylamino)methyl]-3-[3,5-difluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135148473 |
| Molecular Formula | C18H23F2N3O2S |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (5S)-5-[(cyclopropylamino)methyl]-3-[3,5-difluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CNC2CC2)CN1c1cc(F)c(N2CCCSCC2)c(F)c1 |
| InChI | InChI=1S/C18H23F2N3O2S/c19-15-8-13(9-16(20)17(15)22-4-1-6-26-7-5-22)23-11-14(25-18(23)24)10-21-12-2-3-12/h8-9,12,14,21H,1-7,10-11H2/t14-/m0/s1 |
| InChIKey | BTQGNCKFYDVMCA-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|