C23H26F2N2O5S2 — CID 126495985
[(5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 126495985) has the molecular formula C23H26F2N2O5S2 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126495985 |
| Molecular Formula | C23H26F2N2O5S2 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | [(5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CN(c3cc(F)c(N4CCCSCCC4)c(F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H26F2N2O5S2/c1-16-4-6-19(7-5-16)34(29,30)31-15-18-14-27(23(28)32-18)17-12-20(24)22(21(25)13-17)26-8-2-10-33-11-3-9-26/h4-7,12-13,18H,2-3,8-11,14-15H2,1H3/t18-/m1/s1 |
| InChIKey | ODBLVDOLAMTVOR-GOSISDBHSA-N |
| XLogP | 4.34 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|